Search summary:
Session ID: 101acbd5cf4d6223d326680f2eb63a1f
Search Type: metabolite
Started at: 2010-03-19 01:45:34
Finished at: 2010-03-19 01:46:56
| Field | Result | Source |
|---|---|---|
| Name | ||
| creatine | External | |
| HMDB ID | ||
| HMDB00064 | HMDB | |
| Bigg ID | ||
| 34543 | BIGG | |
| Description | ||
| Creatine is a essential, non-proteinaceous amino acid found in all animals and, in some plants. Creatine is synthesized in the kidney, liver and pancreas from L-arginine, glycine and L-methionine. Following its biosynthesis, creatine is transported to the skeletal muscle, heart, brain and other tissues. Most of the creatine is metabolized in these tissues to phosphocreatine (creatine phosphate). Phosphocreatine is a major energy storage form in the body. Supplemental creatine may have an energy-generating action during anaerobic exercise and may also have neuroprotective and cardioprotective actions. | DrugBank | |
| Creatine is a nitrogenous organic acid that occurs naturally in vertebrates and helps to supply energy to muscle. Creatine was identified in 1832 when Michel Eugène Chevreul discovered it as a component of skeletal muscle, which he later named creatine after the Greek word for flesh, κρέας (kreas). | Wikipedia | |
| Creatine is an amino acid that occurs in vertebrate tissues and in urine. In muscle tissue, creatine generally occurs as phosphocreatine. Creatine is excreted as creatinine in the urine. Creatine functions as part of the cell's energy shuttle. The high energy phosphate group of ATP is transferred to creatine to form phosphocreatine in the following reaction: Cr + ATP <-> PCr + ADP. This reaction is reversibly catalyzed by creatine kinase. In the human body creatine is synthesized mainly in the liver by the use of parts from three different amino acids - arginine, glycine, and methionine. 95% of it is later stored in the skeletal muscles, with the rest in the brain, heart, testes. | HMDB | |
| The enzyme GATM (L-arginine:glycine amidinotransferase (AGAT), EC 2.1.4.1) is a mitochondrial enzyme responsible for catalyzing the first rate-limiting step of creatine biosynthesis, and is primarily expressed in the kidneys and pancreas. | Wikipedia | |
| Chemical Kingdom | ||
| Organic | BioSpider | |
| Chemical Class | ||
| Amino Acids | HMDB | |
| Nitrogenous Compounds | NuGO | |
| Chemical Species | ||
| carboxylic acid | Checkmol | |
| guanidine | Checkmol | |
| Synonym | ||
| (α-methylguanido)acetic acid | NIST | |
| ((amino(imino)methyl)(methyl)amino)acetate | HMDB | |
| ((amino(imino)methyl)(methyl)amino)acetic acid | HMDB | |
| (.alpha.-methylguanido)acetic acid | Pubchem | |
| (alpha-methylguanido)acetate | HMDB | |
| (alpha-methylguanido)acetic acid | HMDB | |
| (n-methylcarbamimidamido)acetic acid | Pubchem | |
| 2-(carbamimidoyl-methylamino)acetic acid | Pubchem | |
| Alpha-methylguanidino acetic acid | BIGG | |
| C0780_SIGMA | Pubchem | |
| CRN | Pubchem | |
| Cosmocair C 100 | HMDB | |
| Creatin | HMDB | |
| Creatine (8CI) | Pubchem | |
| Creatine hydrate | HMDB | |
| Creatine, hydrate | NIST | |
| Glycine, n-(aminoiminomethyl)-n-methyl- | Pubchem | |
| IOM | Pubchem | |
| Kreatin | HMDB | |
| Krebiozon | HMDB | |
| Methylglycocyamine | BIGG | |
| Methylguanidinoacetic acid | Pubchem | |
| Methylguanidoacetate | HMDB | |
| Methylguanidoacetic acid | HMDB | |
| N-(aminoiminomethyl)-n-methyl-glycine | HMDB | |
| N-(aminoiminomethyl)-n-methylglycine | Pubchem | |
| N-[(e)-amino(imino)methyl]-n-methylglycine | Pubchem | |
| N-[amino(imino)methyl]-n-methylglycine | Pubchem | |
| N-amidinosarcosine | Pubchem | |
| N-carbamimidoyl-n-methylglycine | Pubchem | |
| N-methyl-n-guanylglycine | HMDB | |
| Phosphagen | HMDB | |
| Pyrolysate | Pubchem | |
| UNL | Pubchem | |
| [[amino(imino)methyl](methyl)amino]acetate | HMDB | |
| [[amino(imino)methyl](methyl)amino]acetic acid | HMDB | |
| CAS | ||
| 57-00-1 | BIGG | |
| InChI Identifier | ||
InChI=1/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9) |
World Wide Molecular Matrix | |
| IUPAC | ||
| 2-(carbamimidoyl-methyl-amino)acetic acid | HMDB | |
| Chemical Formula | ||
| C4H9N3O2 | BIGG | |
| Chemical Structure | ||
 |
Molconvert | |
| Average Molecular Weight (g/mol) | ||
| 131.133160 | BioSpider | |
| Monoisotopic Molecular Weight (g/mol) | ||
| 131.069480 | BioSpider | |
| SMILES (Isomeric) | ||
O=C(O)CN(C(=[N@H])N)C |
ChemSpider | |
| SMILES (Canonical) | ||
CN(CC(O)=O)C(N)=N |
HMDB | |
| Kegg Compound | ||
| C00300 | HMDB | |
| Pubchem Compound ID | ||
| 586 | HMDB | |
| Pubchem Substance ID | ||
| 10327145 | Pubchem | |
| 10527747 | Pubchem | |
| 148804 | Pubchem | |
| 15170675 | Pubchem | |
| 24438948 | Pubchem | |
| 24857517 | Pubchem | |
| 24892273 | Pubchem | |
| 2549 | HMDB | |
| 3139605 | Pubchem | |
| 3594 | Kegg | |
| 46504868 | Pubchem | |
| 4947662 | Pubchem | |
| 50800367 | Pubchem | |
| 56311485 | Pubchem | |
| 56311510 | Pubchem | |
| 56312867 | Pubchem | |
| 56365626 | Pubchem | |
| 57320315 | Pubchem | |
| 57410916 | Pubchem | |
| 6436486 | Pubchem | |
| 74369 | Pubchem | |
| 7886773 | Pubchem | |
| 7986834 | HMDB | |
| 81065541 | Pubchem | |
| 8137931 | Pubchem | |
| 8143593 | Pubchem | |
| 8150697 | Pubchem | |
| 831847 | Pubchem | |
| 833800 | Pubchem | |
| 83548743 | Pubchem | |
| 85164924 | Pubchem | |
| 855190 | Pubchem | |
| 87457515 | Pubchem | |
| 87565524 | Pubchem | |
| 88828666 | Pubchem | |
| OMIM ID | ||
| 123270 | HMDB | |
| 123280 | HMDB | |
| 123290 | HMDB | |
| 123295 | HMDB | |
| 123310 | HMDB | |
| 123320 | HMDB | |
| 300036 | HMDB | |
| 300352 | HMDB | |
| 601240 | HMDB | |
| 601253 | HMDB | |
| 602360 | HMDB | |
| 607155 | HMDB | |
| ChEBI | ||
| 16919 | HMDB | |
| BioCyc | ||
| CREATINE | HMDB | |
| Wikipedia | ||
| Creatine | HMDB | |
| Melting Point | ||
| 303 oC | HMDB | |
| Charge | ||
| 0 | BIGG | |
| State | ||
| Solid | HMDB | |
| MSDS Link | ||
| 1268984798.pdf | www.sciencelab.com | |
| 1268984800.pdf | HMDB | |
| Experimental Water Solubility | ||
| 13.3 mg/mL at 18 oC [YALKOWSKY,SH & DANNENFELSER,RM (1992)] | PhysProp | |
| Predicted Water Solubility | ||
| 4.11 mg/mL [Predicted by ALOGPS] | Alogps | |
| Experimental LogP | ||
| Not Available | Not Applicable | |
| Predicted LogP | ||
| -0.2 [Predicted by PubChem via XLOGP] | HMDB | |
| -1.59 [Predicted by ALOGPS] | Alogps | |
| -3.72 [MEYLAN,WM & HOWARD,PH (1995)] | PhysProp | |
| pKa | ||
| Not Available | Not Applicable | |
| SDF File | ||
| 1268984742.sdf | Pubchem | |
| Mol File | ||
| 1268984781.mol | Molconvert | |
| Pdb File | ||
| 1268984805.pdb | Molconvert | |
| Mass Spec File | ||
| Not Available | Not Applicable | |
| Associated Disorder | ||
| Argininemia. hyperargininemia, arginase deficiency | Metagene | |
| Creatine deficiency, guanidinoacetate methyltransferase deficiency | Metagene | |
| L-arginine:glycine amidinotransferase deficiency | Metagene | |
| X-linked creatine-transporter defect | Metagene | |
| Pathway | ||
| Not Available | Not Applicable | |
| Enzymes | ||
P06732[ UniProt | Analyze ] |
HMDB | |
P12277[ UniProt | Analyze ] |
HMDB | |
P12532[ UniProt | Analyze ] |
HMDB | |
P17540[ UniProt | Analyze ] |
HMDB | |
P48029[ UniProt | Analyze ] |
HMDB | |
P50440[ UniProt | Analyze ] |
HMDB | |
P54821[ UniProt | Analyze ] |
HMDB | |
Q02535[ UniProt | Analyze ] |
HMDB | |
Q14353[ UniProt | Analyze ] |
HMDB | |
| Compartments | ||
| cytosol | BIGG | |
| extra-organism | BIGG | |
| mitochondria | BIGG | |
| Reaction (query compound consumed) | ||
| Not Available | Not Applicable | |
| Reaction (query compound produced) | ||
| Not Available | Not Applicable | |
| Reaction, reversible (query compound neither consumed nor produced) | ||
| ATP Creatine kinase | BIGG | |
| ATP Creatine kinase (c) | BIGG | |
| Creatine exchange | BIGG | |
| guanidinoacetate N-methyltransferase (c) | BIGG | |
| Reaction (query compound is transported across a membrane) | ||
| Creatine transport (sodium symport) (2:1) | BIGG | |
| Creatine transport to/from mitochondria via diffusion | BIGG |